C12H25NO5 — CID 174910386
azane;8-(1,3,5-trioxan-2-yl)nonanoic acid (PubChem CID 174910386) has the molecular formula C12H25NO5 and a molecular weight of 263.33 g/mol. Its IUPAC name is azane;8-(1,3,5-trioxan-2-yl)nonanoic acid.
| Compound Name | azane;8-(1,3,5-trioxan-2-yl)nonanoic acid |
|---|---|
| PubChem CID | 174910386 |
| Molecular Formula | C12H25NO5 |
| Molecular Weight | 263.33 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | azane;8-(1,3,5-trioxan-2-yl)nonanoic acid |
| SMILES | CC(CCCCCCC(=O)O)C1OCOCO1.N |
| InChI | InChI=1S/C12H22O5.H3N/c1-10(12-16-8-15-9-17-12)6-4-2-3-5-7-11(13)14;/h10,12H,2-9H2,1H3,(H,13,14);1H3 |
| InChIKey | BFEQUCXEGRDJAS-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 99.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.33 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|