About 2-methylprop-2-enoyl 3-hydroxy-3-(2-hydroxyethoxy)-2-methylprop-2-enoate
2-methylprop-2-enoyl 3-hydroxy-3-(2-hydroxyethoxy)-2-methylprop-2-enoate (PubChem CID 174910675) has the molecular formula C10H14O6
and a molecular weight of 230.22 g/mol. Its IUPAC name is 2-methylprop-2-enoyl 3-hydroxy-3-(2-hydroxyethoxy)-2-methylprop-2-enoate.
Molecular Properties
| Compound Name | 2-methylprop-2-enoyl 3-hydroxy-3-(2-hydroxyethoxy)-2-methylprop-2-enoate |
| PubChem CID | 174910675 |
| Molecular Formula | C10H14O6 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 2-methylprop-2-enoyl 3-hydroxy-3-(2-hydroxyethoxy)-2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(=O)C(C)=C(O)OCCO |
| InChI | InChI=1S/C10H14O6/c1-6(2)8(12)16-10(14)7(3)9(13)15-5-4-11/h11,13H,1,4-5H2,2-3H3 |
| InChIKey | KTFSIYDBTWSTBC-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylprop-2-enoyl 3-hydroxy-3-(2-hydroxyethoxy)-2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylprop-2-enoyl 3-hydroxy-3-(2-hydroxyethoxy)-2-methylprop-2-enoate?
The IUPAC name of 2-methylprop-2-enoyl 3-hydroxy-3-(2-hydroxyethoxy)-2-methylprop-2-enoate (CID 174910675) is 2-methylprop-2-enoyl 3-hydroxy-3-(2-hydroxyethoxy)-2-methylprop-2-enoate.
What is the SMILES notation for 2-methylprop-2-enoyl 3-hydroxy-3-(2-hydroxyethoxy)-2-methylprop-2-enoate?
The canonical SMILES for 2-methylprop-2-enoyl 3-hydroxy-3-(2-hydroxyethoxy)-2-methylprop-2-enoate is C=C(C)C(=O)OC(=O)C(C)=C(O)OCCO.
What is the InChIKey of 2-methylprop-2-enoyl 3-hydroxy-3-(2-hydroxyethoxy)-2-methylprop-2-enoate?
The InChIKey is KTFSIYDBTWSTBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O6/c1-6(2)8(12)16-10(14)7(3)9(13)15-5-4-11/h11,13H,1,4-5H2,2-3H3.
What are the key properties of 2-methylprop-2-enoyl 3-hydroxy-3-(2-hydroxyethoxy)-2-methylprop-2-enoate?
2-methylprop-2-enoyl 3-hydroxy-3-(2-hydroxyethoxy)-2-methylprop-2-enoate has a molecular weight of 230.22 g/mol, XLogP of 0.43, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylprop-2-enoyl 3-hydroxy-3-(2-hydroxyethoxy)-2-methylprop-2-enoate is sourced from PubChem (CID 174910675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).