C17H16F3NO2 — CID 174937157
1-(3,5-dimethoxyphenyl)-6-(trifluoromethyl)-2,3-dihydroindole (PubChem CID 174937157) has the molecular formula C17H16F3NO2 and a molecular weight of 323.31 g/mol. Its IUPAC name is 1-(3,5-dimethoxyphenyl)-6-(trifluoromethyl)-2,3-dihydroindole.
| Compound Name | 1-(3,5-dimethoxyphenyl)-6-(trifluoromethyl)-2,3-dihydroindole |
|---|---|
| PubChem CID | 174937157 |
| Molecular Formula | C17H16F3NO2 |
| Molecular Weight | 323.31 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 1-(3,5-dimethoxyphenyl)-6-(trifluoromethyl)-2,3-dihydroindole |
| SMILES | COc1cc(OC)cc(N2CCc3ccc(C(F)(F)F)cc32)c1 |
| InChI | InChI=1S/C17H16F3NO2/c1-22-14-8-13(9-15(10-14)23-2)21-6-5-11-3-4-12(7-16(11)21)17(18,19)20/h3-4,7-10H,5-6H2,1-2H3 |
| InChIKey | POSQPKOLMUSYGE-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.31 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |