C16H23NO4S — CID 174953810
2,3,4,6-tetramethyl-5-[3-(prop-2-enoylamino)propyl]benzenesulfonic acid (PubChem CID 174953810) has the molecular formula C16H23NO4S and a molecular weight of 325.43 g/mol. Its IUPAC name is 2,3,4,6-tetramethyl-5-[3-(prop-2-enoylamino)propyl]benzenesulfonic acid.
| Compound Name | 2,3,4,6-tetramethyl-5-[3-(prop-2-enoylamino)propyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 174953810 |
| Molecular Formula | C16H23NO4S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 2,3,4,6-tetramethyl-5-[3-(prop-2-enoylamino)propyl]benzenesulfonic acid |
| SMILES | C=CC(=O)NCCCc1c(C)c(C)c(C)c(S(=O)(=O)O)c1C |
| InChI | InChI=1S/C16H23NO4S/c1-6-15(18)17-9-7-8-14-11(3)10(2)12(4)16(13(14)5)22(19,20)21/h6H,1,7-9H2,2-5H3,(H,17,18)(H,19,20,21) |
| InChIKey | CRCFRYKBIGKKPK-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|