C21H35N5 — CID 174955157
12-[2-(1H-pyrazol-5-yl)phenyl]dodecane-1,5,9-triamine (PubChem CID 174955157) has the molecular formula C21H35N5 and a molecular weight of 357.55 g/mol. Its IUPAC name is 12-[2-(1H-pyrazol-5-yl)phenyl]dodecane-1,5,9-triamine.
| Compound Name | 12-[2-(1H-pyrazol-5-yl)phenyl]dodecane-1,5,9-triamine |
|---|---|
| PubChem CID | 174955157 |
| Molecular Formula | C21H35N5 |
| Molecular Weight | 357.55 g/mol |
| Exact Mass | 357.29 |
| IUPAC Name | 12-[2-(1H-pyrazol-5-yl)phenyl]dodecane-1,5,9-triamine |
| SMILES | NCCCCC(N)CCCC(N)CCCc1ccccc1-c1ccn[nH]1 |
| InChI | InChI=1S/C21H35N5/c22-15-4-3-9-18(23)11-6-12-19(24)10-5-8-17-7-1-2-13-20(17)21-14-16-25-26-21/h1-2,7,13-14,16,18-19H,3-6,8-12,15,22-24H2,(H,25,26) |
| InChIKey | FQRRDMUFHYVWRL-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 106.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.55 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|