C17H28N2O6 — CID 174956236
1-benzyl-2,2,3,3,4,5-hexamethoxypiperazine (PubChem CID 174956236) has the molecular formula C17H28N2O6 and a molecular weight of 356.42 g/mol. Its IUPAC name is 1-benzyl-2,2,3,3,4,5-hexamethoxypiperazine.
| Compound Name | 1-benzyl-2,2,3,3,4,5-hexamethoxypiperazine |
|---|---|
| PubChem CID | 174956236 |
| Molecular Formula | C17H28N2O6 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | 1-benzyl-2,2,3,3,4,5-hexamethoxypiperazine |
| SMILES | COC1CN(Cc2ccccc2)C(OC)(OC)C(OC)(OC)N1OC |
| InChI | InChI=1S/C17H28N2O6/c1-20-15-13-18(12-14-10-8-7-9-11-14)16(21-2,22-3)17(23-4,24-5)19(15)25-6/h7-11,15H,12-13H2,1-6H3 |
| InChIKey | GZEKWTGKLGOQHP-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 61.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|