C9H14N2O — CID 174961911
1-ethenyl-1,3-bis(prop-2-enyl)urea (PubChem CID 174961911) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is 1-ethenyl-1,3-bis(prop-2-enyl)urea.
| Compound Name | 1-ethenyl-1,3-bis(prop-2-enyl)urea |
|---|---|
| PubChem CID | 174961911 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | 1-ethenyl-1,3-bis(prop-2-enyl)urea |
| SMILES | C=CCNC(=O)N(C=C)CC=C |
| InChI | InChI=1S/C9H14N2O/c1-4-7-10-9(12)11(6-3)8-5-2/h4-6H,1-3,7-8H2,(H,10,12) |
| InChIKey | OMHPQRFELDZPBI-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|