About cyclohexanecarboxylic acid;oxepan-2-one
cyclohexanecarboxylic acid;oxepan-2-one (PubChem CID 174966335) has the molecular formula C13H22O4
and a molecular weight of 242.31 g/mol. Its IUPAC name is cyclohexanecarboxylic acid;oxepan-2-one.
Molecular Properties
| Compound Name | cyclohexanecarboxylic acid;oxepan-2-one |
| PubChem CID | 174966335 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | cyclohexanecarboxylic acid;oxepan-2-one |
| SMILES | O=C(O)C1CCCCC1.O=C1CCCCCO1 |
| InChI | InChI=1S/C7H12O2.C6H10O2/c8-7(9)6-4-2-1-3-5-6;7-6-4-2-1-3-5-8-6/h6H,1-5H2,(H,8,9);1-5H2 |
| InChIKey | YGFGQUOYQXGKCG-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclohexanecarboxylic acid;oxepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexanecarboxylic acid;oxepan-2-one?
The IUPAC name of cyclohexanecarboxylic acid;oxepan-2-one (CID 174966335) is cyclohexanecarboxylic acid;oxepan-2-one.
What is the SMILES notation for cyclohexanecarboxylic acid;oxepan-2-one?
The canonical SMILES for cyclohexanecarboxylic acid;oxepan-2-one is O=C(O)C1CCCCC1.O=C1CCCCCO1.
What is the InChIKey of cyclohexanecarboxylic acid;oxepan-2-one?
The InChIKey is YGFGQUOYQXGKCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O2.C6H10O2/c8-7(9)6-4-2-1-3-5-6;7-6-4-2-1-3-5-8-6/h6H,1-5H2,(H,8,9);1-5H2.
What are the key properties of cyclohexanecarboxylic acid;oxepan-2-one?
cyclohexanecarboxylic acid;oxepan-2-one has a molecular weight of 242.31 g/mol, XLogP of 2.75, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexanecarboxylic acid;oxepan-2-one is sourced from PubChem (CID 174966335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).