C14H12N4O7 — CID 174977973
4-(N-amino-2,4-dinitroanilino)oxy-3-methoxybenzaldehyde (PubChem CID 174977973) has the molecular formula C14H12N4O7 and a molecular weight of 348.27 g/mol. Its IUPAC name is 4-(N-amino-2,4-dinitroanilino)oxy-3-methoxybenzaldehyde.
| Compound Name | 4-(N-amino-2,4-dinitroanilino)oxy-3-methoxybenzaldehyde |
|---|---|
| PubChem CID | 174977973 |
| Molecular Formula | C14H12N4O7 |
| Molecular Weight | 348.27 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | 4-(N-amino-2,4-dinitroanilino)oxy-3-methoxybenzaldehyde |
| SMILES | COc1cc(C=O)ccc1ON(N)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H12N4O7/c1-24-14-6-9(8-19)2-5-13(14)25-16(15)11-4-3-10(17(20)21)7-12(11)18(22)23/h2-8H,15H2,1H3 |
| InChIKey | KIQFZHRHAFLCRJ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 151.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.27 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|