C39H33NO16P2 — CID 58610974
[2-[bis(4-formyl-2-methoxyphenoxy)phosphanyloxymethyl]-5-nitrophenyl] bis(4-formyl-2-methoxyphenyl) phosphite (PubChem CID 58610974) has the molecular formula C39H33NO16P2 and a molecular weight of 833.63 g/mol. Its IUPAC name is [2-[bis(4-formyl-2-methoxyphenoxy)phosphanyloxymethyl]-5-nitrophenyl] bis(4-formyl-2-methoxyphenyl) phosphite.
| Compound Name | [2-[bis(4-formyl-2-methoxyphenoxy)phosphanyloxymethyl]-5-nitrophenyl] bis(4-formyl-2-methoxyphenyl) phosphite |
|---|---|
| PubChem CID | 58610974 |
| Molecular Formula | C39H33NO16P2 |
| Molecular Weight | 833.63 g/mol |
| Exact Mass | 833.13 |
| IUPAC Name | [2-[bis(4-formyl-2-methoxyphenoxy)phosphanyloxymethyl]-5-nitrophenyl] bis(4-formyl-2-methoxyphenyl) phosphite |
| SMILES | COc1cc(C=O)ccc1OP(OCc1ccc([N+](=O)[O-])cc1OP(Oc1ccc(C=O)cc1OC)Oc1ccc(C=O)cc1OC)Oc1ccc(C=O)cc1OC |
| InChI | InChI=1S/C39H33NO16P2/c1-47-36-15-25(20-41)5-11-31(36)52-57(53-32-12-6-26(21-42)16-37(32)48-2)51-24-29-9-10-30(40(45)46)19-35(29)56-58(54-33-13-7-27(22-43)17-38(33)49-3)55-34-14-8-28(23-44)18-39(34)50-4/h5-23H,24H2,1-4H3 |
| InChIKey | KYORTAJUCWVKEC-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 203.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.63 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|