C4H4N2O2S — CID 174982585
N-(2-oxo-1,3-thiazol-3-yl)formamide (PubChem CID 174982585) has the molecular formula C4H4N2O2S and a molecular weight of 144.16 g/mol. Its IUPAC name is N-(2-oxo-1,3-thiazol-3-yl)formamide.
| Compound Name | N-(2-oxo-1,3-thiazol-3-yl)formamide |
|---|---|
| PubChem CID | 174982585 |
| Molecular Formula | C4H4N2O2S |
| Molecular Weight | 144.16 g/mol |
| Exact Mass | 144.00 |
| IUPAC Name | N-(2-oxo-1,3-thiazol-3-yl)formamide |
| SMILES | O=CNn1ccsc1=O |
| InChI | InChI=1S/C4H4N2O2S/c7-3-5-6-1-2-9-4(6)8/h1-3H,(H,5,7) |
| InChIKey | AVRVSDYZMYQMPZ-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.16 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|