C13H15Cl2N3O3 — CID 174992766
4-[(2,5-dichloro-3-nitrophenyl)methyl]-2-methylpiperazine-1-carbaldehyde (PubChem CID 174992766) has the molecular formula C13H15Cl2N3O3 and a molecular weight of 332.19 g/mol. Its IUPAC name is 4-[(2,5-dichloro-3-nitrophenyl)methyl]-2-methylpiperazine-1-carbaldehyde.
| Compound Name | 4-[(2,5-dichloro-3-nitrophenyl)methyl]-2-methylpiperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 174992766 |
| Molecular Formula | C13H15Cl2N3O3 |
| Molecular Weight | 332.19 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | 4-[(2,5-dichloro-3-nitrophenyl)methyl]-2-methylpiperazine-1-carbaldehyde |
| SMILES | CC1CN(Cc2cc(Cl)cc([N+](=O)[O-])c2Cl)CCN1C=O |
| InChI | InChI=1S/C13H15Cl2N3O3/c1-9-6-16(2-3-17(9)8-19)7-10-4-11(14)5-12(13(10)15)18(20)21/h4-5,8-9H,2-3,6-7H2,1H3 |
| InChIKey | DPZSEBJWANYGAX-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.19 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|