C30H51N3O3 — CID 174993412
2-[[(2R)-2-amino-3-phenylpropanoyl]amino]-4,7-dimethyl-6-oxo-5-pentyltetradecanamide (PubChem CID 174993412) has the molecular formula C30H51N3O3 and a molecular weight of 501.76 g/mol. Its IUPAC name is 2-[[(2R)-2-amino-3-phenylpropanoyl]amino]-4,7-dimethyl-6-oxo-5-pentyltetradecanamide.
| Compound Name | 2-[[(2R)-2-amino-3-phenylpropanoyl]amino]-4,7-dimethyl-6-oxo-5-pentyltetradecanamide |
|---|---|
| PubChem CID | 174993412 |
| Molecular Formula | C30H51N3O3 |
| Molecular Weight | 501.76 g/mol |
| Exact Mass | 501.39 |
| IUPAC Name | 2-[[(2R)-2-amino-3-phenylpropanoyl]amino]-4,7-dimethyl-6-oxo-5-pentyltetradecanamide |
| SMILES | CCCCCCCC(C)C(=O)C(CCCCC)C(C)CC(NC(=O)[C@H](N)Cc1ccccc1)C(N)=O |
| InChI | InChI=1S/C30H51N3O3/c1-5-7-9-10-13-16-22(3)28(34)25(19-12-8-6-2)23(4)20-27(29(32)35)33-30(36)26(31)21-24-17-14-11-15-18-24/h11,14-15,17-18,22-23,25-27H,5-10,12-13,16,19-21,31H2,1-4H3,(H2,32,35)(H,33,36)/t22?,23?,25?,26-,27?/m1/s1 |
| InChIKey | LUPSSODFUFSWDP-UYQRJPFMSA-N |
| XLogP | 5.31 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.76 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|