C24H25N5O4 — CID 175002603
[6-[[8-(4-hydroxycyclohexyl)oxyquinolin-2-yl]amino]-1H-benzimidazol-4-yl]methyl carbamate (PubChem CID 175002603) has the molecular formula C24H25N5O4 and a molecular weight of 447.50 g/mol. Its IUPAC name is [6-[[8-(4-hydroxycyclohexyl)oxyquinolin-2-yl]amino]-1H-benzimidazol-4-yl]methyl carbamate.
| Compound Name | [6-[[8-(4-hydroxycyclohexyl)oxyquinolin-2-yl]amino]-1H-benzimidazol-4-yl]methyl carbamate |
|---|---|
| PubChem CID | 175002603 |
| Molecular Formula | C24H25N5O4 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | [6-[[8-(4-hydroxycyclohexyl)oxyquinolin-2-yl]amino]-1H-benzimidazol-4-yl]methyl carbamate |
| SMILES | NC(=O)OCc1cc(Nc2ccc3cccc(OC4CCC(O)CC4)c3n2)cc2[nH]cnc12 |
| InChI | InChI=1S/C24H25N5O4/c25-24(31)32-12-15-10-16(11-19-22(15)27-13-26-19)28-21-9-4-14-2-1-3-20(23(14)29-21)33-18-7-5-17(30)6-8-18/h1-4,9-11,13,17-18,30H,5-8,12H2,(H2,25,31)(H,26,27)(H,28,29) |
| InChIKey | IWQJLBGTHHJAKE-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 135.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |