C31H35F3N8O4 — CID 175005079
tert-butyl N-[ethyl-[5-[[4-(1-methylindol-3-yl)pyrimidin-2-yl]amino]-3-(prop-2-enoylamino)-6-(2,2,2-trifluoroethoxy)-2-pyridinyl]amino]-N-methylcarbamate (PubChem CID 175005079) has the molecular formula C31H35F3N8O4 and a molecular weight of 640.67 g/mol. Its IUPAC name is tert-butyl N-[ethyl-[5-[[4-(1-methylindol-3-yl)pyrimidin-2-yl]amino]-3-(prop-2-enoylamino)-6-(2,2,2-trifluoroethoxy)-2-pyridinyl]amino]-N-methylcarbamate.
| Compound Name | tert-butyl N-[ethyl-[5-[[4-(1-methylindol-3-yl)pyrimidin-2-yl]amino]-3-(prop-2-enoylamino)-6-(2,2,2-trifluoroethoxy)-2-pyridinyl]amino]-N-methylcarbamate |
|---|---|
| PubChem CID | 175005079 |
| Molecular Formula | C31H35F3N8O4 |
| Molecular Weight | 640.67 g/mol |
| Exact Mass | 640.27 |
| IUPAC Name | tert-butyl N-[ethyl-[5-[[4-(1-methylindol-3-yl)pyrimidin-2-yl]amino]-3-(prop-2-enoylamino)-6-(2,2,2-trifluoroethoxy)-2-pyridinyl]amino]-N-methylcarbamate |
| SMILES | C=CC(=O)Nc1cc(Nc2nccc(-c3cn(C)c4ccccc34)n2)c(OCC(F)(F)F)nc1N(CC)N(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C31H35F3N8O4/c1-8-25(43)36-22-16-23(38-28-35-15-14-21(37-28)20-17-40(6)24-13-11-10-12-19(20)24)27(45-18-31(32,33)34)39-26(22)42(9-2)41(7)29(44)46-30(3,4)5/h8,10-17H,1,9,18H2,2-7H3,(H,36,43)(H,35,37,38) |
| InChIKey | BFRCYAOCNGJTNN-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.67 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|