C31H35F3N8O4 — CID 175336048
2-methylbutan-2-yl N-[ethyl-[5-[[4-(1-methylindol-3-yl)pyrimidin-2-yl]amino]-3-(prop-2-enoylamino)-6-(2,2,2-trifluoroethoxy)-2-pyridinyl]amino]carbamate (PubChem CID 175336048) has the molecular formula C31H35F3N8O4 and a molecular weight of 640.67 g/mol. Its IUPAC name is 2-methylbutan-2-yl N-[ethyl-[5-[[4-(1-methylindol-3-yl)pyrimidin-2-yl]amino]-3-(prop-2-enoylamino)-6-(2,2,2-trifluoroethoxy)-2-pyridinyl]amino]carbamate.
| Compound Name | 2-methylbutan-2-yl N-[ethyl-[5-[[4-(1-methylindol-3-yl)pyrimidin-2-yl]amino]-3-(prop-2-enoylamino)-6-(2,2,2-trifluoroethoxy)-2-pyridinyl]amino]carbamate |
|---|---|
| PubChem CID | 175336048 |
| Molecular Formula | C31H35F3N8O4 |
| Molecular Weight | 640.67 g/mol |
| Exact Mass | 640.27 |
| IUPAC Name | 2-methylbutan-2-yl N-[ethyl-[5-[[4-(1-methylindol-3-yl)pyrimidin-2-yl]amino]-3-(prop-2-enoylamino)-6-(2,2,2-trifluoroethoxy)-2-pyridinyl]amino]carbamate |
| SMILES | C=CC(=O)Nc1cc(Nc2nccc(-c3cn(C)c4ccccc34)n2)c(OCC(F)(F)F)nc1N(CC)NC(=O)OC(C)(C)CC |
| InChI | InChI=1S/C31H35F3N8O4/c1-7-25(43)36-22-16-23(38-28-35-15-14-21(37-28)20-17-41(6)24-13-11-10-12-19(20)24)27(45-18-31(32,33)34)39-26(22)42(9-3)40-29(44)46-30(4,5)8-2/h7,10-17H,1,8-9,18H2,2-6H3,(H,36,43)(H,40,44)(H,35,37,38) |
| InChIKey | KRILIBOGTLIUEY-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 135.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.67 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|