C6H17NO7S — CID 175015105
2-[2-hydroxyethoxy(methyl)amino]oxyethanol;methanesulfonic acid (PubChem CID 175015105) has the molecular formula C6H17NO7S and a molecular weight of 247.27 g/mol. Its IUPAC name is 2-[2-hydroxyethoxy(methyl)amino]oxyethanol;methanesulfonic acid.
| Compound Name | 2-[2-hydroxyethoxy(methyl)amino]oxyethanol;methanesulfonic acid |
|---|---|
| PubChem CID | 175015105 |
| Molecular Formula | C6H17NO7S |
| Molecular Weight | 247.27 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | 2-[2-hydroxyethoxy(methyl)amino]oxyethanol;methanesulfonic acid |
| SMILES | CN(OCCO)OCCO.CS(=O)(=O)O |
| InChI | InChI=1S/C5H13NO4.CH4O3S/c1-6(9-4-2-7)10-5-3-8;1-5(2,3)4/h7-8H,2-5H2,1H3;1H3,(H,2,3,4) |
| InChIKey | OOTSGEDBACDFEU-UHFFFAOYSA-N |
| XLogP | -1.73 |
| TPSA | 116.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.27 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|