About 2-[2-hydroxyethoxy(methyl)amino]oxyethanol;prop-2-enamide
2-[2-hydroxyethoxy(methyl)amino]oxyethanol;prop-2-enamide (PubChem CID 174799065) has the molecular formula C8H18N2O5
and a molecular weight of 222.24 g/mol. Its IUPAC name is 2-[2-hydroxyethoxy(methyl)amino]oxyethanol;prop-2-enamide.
Molecular Properties
| Compound Name | 2-[2-hydroxyethoxy(methyl)amino]oxyethanol;prop-2-enamide |
| PubChem CID | 174799065 |
| Molecular Formula | C8H18N2O5 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 2-[2-hydroxyethoxy(methyl)amino]oxyethanol;prop-2-enamide |
| SMILES | C=CC(N)=O.CN(OCCO)OCCO |
| InChI | InChI=1S/C5H13NO4.C3H5NO/c1-6(9-4-2-7)10-5-3-8;1-2-3(4)5/h7-8H,2-5H2,1H3;2H,1H2,(H2,4,5) |
| InChIKey | COZIAGPUXBLHHV-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-hydroxyethoxy(methyl)amino]oxyethanol;prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-hydroxyethoxy(methyl)amino]oxyethanol;prop-2-enamide?
The IUPAC name of 2-[2-hydroxyethoxy(methyl)amino]oxyethanol;prop-2-enamide (CID 174799065) is 2-[2-hydroxyethoxy(methyl)amino]oxyethanol;prop-2-enamide.
What is the SMILES notation for 2-[2-hydroxyethoxy(methyl)amino]oxyethanol;prop-2-enamide?
The canonical SMILES for 2-[2-hydroxyethoxy(methyl)amino]oxyethanol;prop-2-enamide is C=CC(N)=O.CN(OCCO)OCCO.
What is the InChIKey of 2-[2-hydroxyethoxy(methyl)amino]oxyethanol;prop-2-enamide?
The InChIKey is COZIAGPUXBLHHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13NO4.C3H5NO/c1-6(9-4-2-7)10-5-3-8;1-2-3(4)5/h7-8H,2-5H2,1H3;2H,1H2,(H2,4,5).
What are the key properties of 2-[2-hydroxyethoxy(methyl)amino]oxyethanol;prop-2-enamide?
2-[2-hydroxyethoxy(methyl)amino]oxyethanol;prop-2-enamide has a molecular weight of 222.24 g/mol, XLogP of -1.58, 7 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-hydroxyethoxy(methyl)amino]oxyethanol;prop-2-enamide is sourced from PubChem (CID 174799065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).