C7H16N2O8S — CID 88674774
2-[bis(2-hydroxyethoxy)amino]propanenitrile;sulfuric acid (PubChem CID 88674774) has the molecular formula C7H16N2O8S and a molecular weight of 288.28 g/mol. Its IUPAC name is 2-[bis(2-hydroxyethoxy)amino]propanenitrile;sulfuric acid.
| Compound Name | 2-[bis(2-hydroxyethoxy)amino]propanenitrile;sulfuric acid |
|---|---|
| PubChem CID | 88674774 |
| Molecular Formula | C7H16N2O8S |
| Molecular Weight | 288.28 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 2-[bis(2-hydroxyethoxy)amino]propanenitrile;sulfuric acid |
| SMILES | CC(C#N)N(OCCO)OCCO.O=S(=O)(O)O |
| InChI | InChI=1S/C7H14N2O4.H2O4S/c1-7(6-8)9(12-4-2-10)13-5-3-11;1-5(2,3)4/h7,10-11H,2-5H2,1H3;(H2,1,2,3,4) |
| InChIKey | VTLZRWHFOQHHSK-UHFFFAOYSA-N |
| XLogP | -1.60 |
| TPSA | 160.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.28 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|