C19H25F3O3 — CID 175017915
[3-(2,4,6-trifluorophenoxy)cyclobutyl] 2-methyloctanoate (PubChem CID 175017915) has the molecular formula C19H25F3O3 and a molecular weight of 358.40 g/mol. Its IUPAC name is [3-(2,4,6-trifluorophenoxy)cyclobutyl] 2-methyloctanoate.
| Compound Name | [3-(2,4,6-trifluorophenoxy)cyclobutyl] 2-methyloctanoate |
|---|---|
| PubChem CID | 175017915 |
| Molecular Formula | C19H25F3O3 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | [3-(2,4,6-trifluorophenoxy)cyclobutyl] 2-methyloctanoate |
| SMILES | CCCCCCC(C)C(=O)OC1CC(Oc2c(F)cc(F)cc2F)C1 |
| InChI | InChI=1S/C19H25F3O3/c1-3-4-5-6-7-12(2)19(23)25-15-10-14(11-15)24-18-16(21)8-13(20)9-17(18)22/h8-9,12,14-15H,3-7,10-11H2,1-2H3 |
| InChIKey | RMAJGKGGZBHWDB-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|