C20H28ClFO3 — CID 175015756
[3-[(4-chloro-2-fluorophenoxy)methyl]cyclobutyl] 2-methyloctanoate (PubChem CID 175015756) has the molecular formula C20H28ClFO3 and a molecular weight of 370.89 g/mol. Its IUPAC name is [3-[(4-chloro-2-fluorophenoxy)methyl]cyclobutyl] 2-methyloctanoate.
| Compound Name | [3-[(4-chloro-2-fluorophenoxy)methyl]cyclobutyl] 2-methyloctanoate |
|---|---|
| PubChem CID | 175015756 |
| Molecular Formula | C20H28ClFO3 |
| Molecular Weight | 370.89 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | [3-[(4-chloro-2-fluorophenoxy)methyl]cyclobutyl] 2-methyloctanoate |
| SMILES | CCCCCCC(C)C(=O)OC1CC(COc2ccc(Cl)cc2F)C1 |
| InChI | InChI=1S/C20H28ClFO3/c1-3-4-5-6-7-14(2)20(23)25-17-10-15(11-17)13-24-19-9-8-16(21)12-18(19)22/h8-9,12,14-15,17H,3-7,10-11,13H2,1-2H3 |
| InChIKey | UXODVAFVFVMLRK-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.89 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|