C16H19N2O3PS — CID 175018770
2-[(2-aminopyrrolidin-1-yl)-phenylphosphanyl]benzenesulfonic acid (PubChem CID 175018770) has the molecular formula C16H19N2O3PS and a molecular weight of 350.38 g/mol. Its IUPAC name is 2-[(2-aminopyrrolidin-1-yl)-phenylphosphanyl]benzenesulfonic acid.
| Compound Name | 2-[(2-aminopyrrolidin-1-yl)-phenylphosphanyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 175018770 |
| Molecular Formula | C16H19N2O3PS |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 2-[(2-aminopyrrolidin-1-yl)-phenylphosphanyl]benzenesulfonic acid |
| SMILES | NC1CCCN1P(c1ccccc1)c1ccccc1S(=O)(=O)O |
| InChI | InChI=1S/C16H19N2O3PS/c17-16-11-6-12-18(16)22(13-7-2-1-3-8-13)14-9-4-5-10-15(14)23(19,20)21/h1-5,7-10,16H,6,11-12,17H2,(H,19,20,21) |
| InChIKey | GQPSLJBKNLVAOI-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|