C13H22N2O5 — CID 175021040
[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl] 1-methylpyrrolidine-2-carboxylate (PubChem CID 175021040) has the molecular formula C13H22N2O5 and a molecular weight of 286.33 g/mol. Its IUPAC name is [2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl] 1-methylpyrrolidine-2-carboxylate.
| Compound Name | [2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl] 1-methylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 175021040 |
| Molecular Formula | C13H22N2O5 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | [2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl] 1-methylpyrrolidine-2-carboxylate |
| SMILES | CN1CCCC1C(=O)OC(=O)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H22N2O5/c1-13(2,3)20-12(18)14-8-10(16)19-11(17)9-6-5-7-15(9)4/h9H,5-8H2,1-4H3,(H,14,18) |
| InChIKey | MKXRZTYOKCGJGP-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|