C28H28O8 — CID 175023803
benzoic acid;methyl (E)-5-oxo-5-phenyl-2-(3,4,5-trimethoxyphenyl)pent-3-enoate (PubChem CID 175023803) has the molecular formula C28H28O8 and a molecular weight of 492.52 g/mol. Its IUPAC name is benzoic acid;methyl (E)-5-oxo-5-phenyl-2-(3,4,5-trimethoxyphenyl)pent-3-enoate.
| Compound Name | benzoic acid;methyl (E)-5-oxo-5-phenyl-2-(3,4,5-trimethoxyphenyl)pent-3-enoate |
|---|---|
| PubChem CID | 175023803 |
| Molecular Formula | C28H28O8 |
| Molecular Weight | 492.52 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | benzoic acid;methyl (E)-5-oxo-5-phenyl-2-(3,4,5-trimethoxyphenyl)pent-3-enoate |
| SMILES | COC(=O)C(/C=C/C(=O)c1ccccc1)c1cc(OC)c(OC)c(OC)c1.O=C(O)c1ccccc1 |
| InChI | InChI=1S/C21H22O6.C7H6O2/c1-24-18-12-15(13-19(25-2)20(18)26-3)16(21(23)27-4)10-11-17(22)14-8-6-5-7-9-14;8-7(9)6-4-2-1-3-5-6/h5-13,16H,1-4H3;1-5H,(H,8,9)/b11-10+; |
| InChIKey | YIUGACDZNIGWOR-ASTDGNLGSA-N |
| XLogP | 4.79 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.52 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|