C27H29N2O4S- — CID 175024240
1-[[(2S)-1-carboxypropan-2-yl]-prop-2-ynylamino]-4-(2,3,5,6-tetramethyl-N-sulfinatoanilino)naphthalene (PubChem CID 175024240) has the molecular formula C27H29N2O4S- and a molecular weight of 477.61 g/mol. Its IUPAC name is 1-[[(2S)-1-carboxypropan-2-yl]-prop-2-ynylamino]-4-(2,3,5,6-tetramethyl-N-sulfinatoanilino)naphthalene.
| Compound Name | 1-[[(2S)-1-carboxypropan-2-yl]-prop-2-ynylamino]-4-(2,3,5,6-tetramethyl-N-sulfinatoanilino)naphthalene |
|---|---|
| PubChem CID | 175024240 |
| Molecular Formula | C27H29N2O4S- |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | 1-[[(2S)-1-carboxypropan-2-yl]-prop-2-ynylamino]-4-(2,3,5,6-tetramethyl-N-sulfinatoanilino)naphthalene |
| SMILES | C#CCN(c1ccc(N(c2c(C)c(C)cc(C)c2C)S(=O)[O-])c2ccccc12)[C@@H](C)CC(=O)O |
| InChI | InChI=1S/C27H30N2O4S/c1-7-14-28(19(4)16-26(30)31)24-12-13-25(23-11-9-8-10-22(23)24)29(34(32)33)27-20(5)17(2)15-18(3)21(27)6/h1,8-13,15,19H,14,16H2,2-6H3,(H,30,31)(H,32,33)/p-1/t19-/m0/s1 |
| InChIKey | GMXLYYAUQHRLAS-IBGZPJMESA-M |
| XLogP | 5.31 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|