C28H30N2O4S — CID 166999075
methyl (3S)-3-[[4-[(2-methoxy-2-oxoethyl)-(2-methylphenyl)sulfanylamino]naphthalen-1-yl]-prop-2-ynylamino]butanoate (PubChem CID 166999075) has the molecular formula C28H30N2O4S and a molecular weight of 490.63 g/mol. Its IUPAC name is methyl (3S)-3-[[4-[(2-methoxy-2-oxoethyl)-(2-methylphenyl)sulfanylamino]naphthalen-1-yl]-prop-2-ynylamino]butanoate.
| Compound Name | methyl (3S)-3-[[4-[(2-methoxy-2-oxoethyl)-(2-methylphenyl)sulfanylamino]naphthalen-1-yl]-prop-2-ynylamino]butanoate |
|---|---|
| PubChem CID | 166999075 |
| Molecular Formula | C28H30N2O4S |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | methyl (3S)-3-[[4-[(2-methoxy-2-oxoethyl)-(2-methylphenyl)sulfanylamino]naphthalen-1-yl]-prop-2-ynylamino]butanoate |
| SMILES | C#CCN(c1ccc(N(CC(=O)OC)Sc2ccccc2C)c2ccccc12)[C@@H](C)CC(=O)OC |
| InChI | InChI=1S/C28H30N2O4S/c1-6-17-29(21(3)18-27(31)33-4)24-15-16-25(23-13-9-8-12-22(23)24)30(19-28(32)34-5)35-26-14-10-7-11-20(26)2/h1,7-16,21H,17-19H2,2-5H3/t21-/m0/s1 |
| InChIKey | PQYLKUWNSNVCNT-NRFANRHFSA-N |
| XLogP | 5.23 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|