About 2-methylbutan-2-ylsilyl trifluoromethanesulfonate
2-methylbutan-2-ylsilyl trifluoromethanesulfonate (PubChem CID 175025137) has the molecular formula C6H13F3O3SSi
and a molecular weight of 250.31 g/mol. Its IUPAC name is 2-methylbutan-2-ylsilyl trifluoromethanesulfonate.
Molecular Properties
| Compound Name | 2-methylbutan-2-ylsilyl trifluoromethanesulfonate |
| PubChem CID | 175025137 |
| Molecular Formula | C6H13F3O3SSi |
| Molecular Weight | 250.31 g/mol |
| Exact Mass | 250.03 |
| IUPAC Name | 2-methylbutan-2-ylsilyl trifluoromethanesulfonate |
| SMILES | CCC(C)(C)[SiH2]OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C6H13F3O3SSi/c1-4-5(2,3)14-12-13(10,11)6(7,8)9/h4,14H2,1-3H3 |
| InChIKey | IVJULBQNDVBNBL-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.31 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbutan-2-ylsilyl trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbutan-2-ylsilyl trifluoromethanesulfonate?
The IUPAC name of 2-methylbutan-2-ylsilyl trifluoromethanesulfonate (CID 175025137) is 2-methylbutan-2-ylsilyl trifluoromethanesulfonate.
What is the SMILES notation for 2-methylbutan-2-ylsilyl trifluoromethanesulfonate?
The canonical SMILES for 2-methylbutan-2-ylsilyl trifluoromethanesulfonate is CCC(C)(C)[SiH2]OS(=O)(=O)C(F)(F)F.
What is the InChIKey of 2-methylbutan-2-ylsilyl trifluoromethanesulfonate?
The InChIKey is IVJULBQNDVBNBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13F3O3SSi/c1-4-5(2,3)14-12-13(10,11)6(7,8)9/h4,14H2,1-3H3.
What are the key properties of 2-methylbutan-2-ylsilyl trifluoromethanesulfonate?
2-methylbutan-2-ylsilyl trifluoromethanesulfonate has a molecular weight of 250.31 g/mol, XLogP of 1.54, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbutan-2-ylsilyl trifluoromethanesulfonate is sourced from PubChem (CID 175025137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).