C13H13ClFN3O2S — CID 175027029
[5-tert-butyl-4-(5-chloro-2-fluoro-4-pyridinyl)-1,3-thiazol-2-yl] carbamate (PubChem CID 175027029) has the molecular formula C13H13ClFN3O2S and a molecular weight of 329.78 g/mol. Its IUPAC name is [5-tert-butyl-4-(5-chloro-2-fluoro-4-pyridinyl)-1,3-thiazol-2-yl] carbamate.
| Compound Name | [5-tert-butyl-4-(5-chloro-2-fluoro-4-pyridinyl)-1,3-thiazol-2-yl] carbamate |
|---|---|
| PubChem CID | 175027029 |
| Molecular Formula | C13H13ClFN3O2S |
| Molecular Weight | 329.78 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | [5-tert-butyl-4-(5-chloro-2-fluoro-4-pyridinyl)-1,3-thiazol-2-yl] carbamate |
| SMILES | CC(C)(C)c1sc(OC(N)=O)nc1-c1cc(F)ncc1Cl |
| InChI | InChI=1S/C13H13ClFN3O2S/c1-13(2,3)10-9(18-12(21-10)20-11(16)19)6-4-8(15)17-5-7(6)14/h4-5H,1-3H3,(H2,16,19) |
| InChIKey | XHMXXGPIJOAIQZ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.78 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|