C8H16N2O3 — CID 175042141
(2S,5R)-5-(methoxymethylamino)piperidine-2-carboxylic acid (PubChem CID 175042141) has the molecular formula C8H16N2O3 and a molecular weight of 188.23 g/mol. Its IUPAC name is (2S,5R)-5-(methoxymethylamino)piperidine-2-carboxylic acid.
| Compound Name | (2S,5R)-5-(methoxymethylamino)piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 175042141 |
| Molecular Formula | C8H16N2O3 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | (2S,5R)-5-(methoxymethylamino)piperidine-2-carboxylic acid |
| SMILES | COCN[C@@H]1CC[C@@H](C(=O)O)NC1 |
| InChI | InChI=1S/C8H16N2O3/c1-13-5-10-6-2-3-7(8(11)12)9-4-6/h6-7,9-10H,2-5H2,1H3,(H,11,12)/t6-,7+/m1/s1 |
| InChIKey | GAHWINRRHDIBCQ-RQJHMYQMSA-N |
| XLogP | -0.61 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|