C9H16N2O3 — CID 87217262
(2S,5R)-5-(prop-2-enoxyamino)piperidine-2-carboxylic acid (PubChem CID 87217262) has the molecular formula C9H16N2O3 and a molecular weight of 200.24 g/mol. Its IUPAC name is (2S,5R)-5-(prop-2-enoxyamino)piperidine-2-carboxylic acid.
| Compound Name | (2S,5R)-5-(prop-2-enoxyamino)piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 87217262 |
| Molecular Formula | C9H16N2O3 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | (2S,5R)-5-(prop-2-enoxyamino)piperidine-2-carboxylic acid |
| SMILES | C=CCON[C@@H]1CC[C@@H](C(=O)O)NC1 |
| InChI | InChI=1S/C9H16N2O3/c1-2-5-14-11-7-3-4-8(9(12)13)10-6-7/h2,7-8,10-11H,1,3-6H2,(H,12,13)/t7-,8+/m1/s1 |
| InChIKey | UKGMRYJBNLZXRT-SFYZADRCSA-N |
| XLogP | -0.10 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|