C21H28O4 — CID 175044376
2-[hydroxy(phenyl)methylidene]-5,5-bis[(2-methylpropan-2-yl)oxy]cyclohex-3-en-1-one (PubChem CID 175044376) has the molecular formula C21H28O4 and a molecular weight of 344.45 g/mol. Its IUPAC name is 2-[hydroxy(phenyl)methylidene]-5,5-bis[(2-methylpropan-2-yl)oxy]cyclohex-3-en-1-one.
| Compound Name | 2-[hydroxy(phenyl)methylidene]-5,5-bis[(2-methylpropan-2-yl)oxy]cyclohex-3-en-1-one |
|---|---|
| PubChem CID | 175044376 |
| Molecular Formula | C21H28O4 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 2-[hydroxy(phenyl)methylidene]-5,5-bis[(2-methylpropan-2-yl)oxy]cyclohex-3-en-1-one |
| SMILES | CC(C)(C)OC1(OC(C)(C)C)C=CC(=C(O)c2ccccc2)C(=O)C1 |
| InChI | InChI=1S/C21H28O4/c1-19(2,3)24-21(25-20(4,5)6)13-12-16(17(22)14-21)18(23)15-10-8-7-9-11-15/h7-13,23H,14H2,1-6H3 |
| InChIKey | RXHLDRDVMGDQDU-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|