C13H12O5 — CID 66681976
5,5-dihydroxy-2-[hydroxy-(2-hydroxyphenyl)methylidene]cyclohex-3-en-1-one (PubChem CID 66681976) has the molecular formula C13H12O5 and a molecular weight of 248.23 g/mol. Its IUPAC name is 5,5-dihydroxy-2-[hydroxy-(2-hydroxyphenyl)methylidene]cyclohex-3-en-1-one.
| Compound Name | 5,5-dihydroxy-2-[hydroxy-(2-hydroxyphenyl)methylidene]cyclohex-3-en-1-one |
|---|---|
| PubChem CID | 66681976 |
| Molecular Formula | C13H12O5 |
| Molecular Weight | 248.23 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | 5,5-dihydroxy-2-[hydroxy-(2-hydroxyphenyl)methylidene]cyclohex-3-en-1-one |
| SMILES | O=C1CC(O)(O)C=CC1=C(O)c1ccccc1O |
| InChI | InChI=1S/C13H12O5/c14-10-4-2-1-3-8(10)12(16)9-5-6-13(17,18)7-11(9)15/h1-6,14,16-18H,7H2 |
| InChIKey | PDQJUHVAIXJALS-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.23 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|