C18H16N2O2 — CID 175057882
2-(dihydroxymethyl)-2,4-diphenylpentanedinitrile (PubChem CID 175057882) has the molecular formula C18H16N2O2 and a molecular weight of 292.34 g/mol. Its IUPAC name is 2-(dihydroxymethyl)-2,4-diphenylpentanedinitrile.
| Compound Name | 2-(dihydroxymethyl)-2,4-diphenylpentanedinitrile |
|---|---|
| PubChem CID | 175057882 |
| Molecular Formula | C18H16N2O2 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 2-(dihydroxymethyl)-2,4-diphenylpentanedinitrile |
| SMILES | N#CC(CC(C#N)(c1ccccc1)C(O)O)c1ccccc1 |
| InChI | InChI=1S/C18H16N2O2/c19-12-15(14-7-3-1-4-8-14)11-18(13-20,17(21)22)16-9-5-2-6-10-16/h1-10,15,17,21-22H,11H2 |
| InChIKey | HZHUCHTXKAKYBB-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 88.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|