C25H40N4O4 — CID 175060950
N-[(3R)-1-[[amino-[cyclohexyl-[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]pentan-3-yl]propanamide (PubChem CID 175060950) has the molecular formula C25H40N4O4 and a molecular weight of 460.62 g/mol. Its IUPAC name is N-[(3R)-1-[[amino-[cyclohexyl-[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]pentan-3-yl]propanamide.
| Compound Name | N-[(3R)-1-[[amino-[cyclohexyl-[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]pentan-3-yl]propanamide |
|---|---|
| PubChem CID | 175060950 |
| Molecular Formula | C25H40N4O4 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.30 |
| IUPAC Name | N-[(3R)-1-[[amino-[cyclohexyl-[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]pentan-3-yl]propanamide |
| SMILES | CCC(=O)N[C@H](CC)CC/N=C(\N)N(C(=O)Cc1ccc(OC)c(OC)c1)C1CCCCC1 |
| InChI | InChI=1S/C25H40N4O4/c1-5-19(28-23(30)6-2)14-15-27-25(26)29(20-10-8-7-9-11-20)24(31)17-18-12-13-21(32-3)22(16-18)33-4/h12-13,16,19-20H,5-11,14-15,17H2,1-4H3,(H2,26,27)(H,28,30)/t19-/m1/s1 |
| InChIKey | GNFWMFIAXIWIBK-LJQANCHMSA-N |
| XLogP | 3.42 |
| TPSA | 106.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|