C19H29N3O3S — CID 21148339
1-cyclohexyl-1-[[2-(3,4-diethoxyphenyl)acetyl]amino]thiourea (PubChem CID 21148339) has the molecular formula C19H29N3O3S and a molecular weight of 379.53 g/mol. Its IUPAC name is 1-cyclohexyl-1-[[2-(3,4-diethoxyphenyl)acetyl]amino]thiourea.
| Compound Name | 1-cyclohexyl-1-[[2-(3,4-diethoxyphenyl)acetyl]amino]thiourea |
|---|---|
| PubChem CID | 21148339 |
| Molecular Formula | C19H29N3O3S |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 1-cyclohexyl-1-[[2-(3,4-diethoxyphenyl)acetyl]amino]thiourea |
| SMILES | CCOc1ccc(CC(=O)NN(C(N)=S)C2CCCCC2)cc1OCC |
| InChI | InChI=1S/C19H29N3O3S/c1-3-24-16-11-10-14(12-17(16)25-4-2)13-18(23)21-22(19(20)26)15-8-6-5-7-9-15/h10-12,15H,3-9,13H2,1-2H3,(H2,20,26)(H,21,23) |
| InChIKey | UNUHCOHFGYNGMV-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|