C17H16N4OS — CID 175063779
3-[(4-methoxyphenyl)methyl]-4-methyl-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,10-pentaen-7-amine (PubChem CID 175063779) has the molecular formula C17H16N4OS and a molecular weight of 324.41 g/mol. Its IUPAC name is 3-[(4-methoxyphenyl)methyl]-4-methyl-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,10-pentaen-7-amine.
| Compound Name | 3-[(4-methoxyphenyl)methyl]-4-methyl-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,10-pentaen-7-amine |
|---|---|
| PubChem CID | 175063779 |
| Molecular Formula | C17H16N4OS |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 3-[(4-methoxyphenyl)methyl]-4-methyl-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,10-pentaen-7-amine |
| SMILES | COc1ccc(Cn2c(C)nc3c(N)nc4ccsc4c32)cc1 |
| InChI | InChI=1S/C17H16N4OS/c1-10-19-14-15(16-13(7-8-23-16)20-17(14)18)21(10)9-11-3-5-12(22-2)6-4-11/h3-8H,9H2,1-2H3,(H2,18,20) |
| InChIKey | JVXGMPGWOKDABY-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |