C23H46NO8P — CID 175066351
2-aminoethyl dihydrogen phosphate;2,3-dihydroxypropyl (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 175066351) has the molecular formula C23H46NO8P and a molecular weight of 495.59 g/mol. Its IUPAC name is 2-aminoethyl dihydrogen phosphate;2,3-dihydroxypropyl (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | 2-aminoethyl dihydrogen phosphate;2,3-dihydroxypropyl (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 175066351 |
| Molecular Formula | C23H46NO8P |
| Molecular Weight | 495.59 g/mol |
| Exact Mass | 495.30 |
| IUPAC Name | 2-aminoethyl dihydrogen phosphate;2,3-dihydroxypropyl (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCC(O)CO.NCCOP(=O)(O)O |
| InChI | InChI=1S/C21H38O4.C2H8NO4P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(24)25-19-20(23)18-22;3-1-2-7-8(4,5)6/h6-7,9-10,20,22-23H,2-5,8,11-19H2,1H3;1-3H2,(H2,4,5,6)/b7-6-,10-9-; |
| InChIKey | PXONIAUBEWMCQC-NBTZWHCOSA-N |
| XLogP | 3.75 |
| TPSA | 159.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.59 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|