About [6-(hydroxymethyl)-2-azaspiro[3.3]heptan-3-yl] 2-methylheptanoate
[6-(hydroxymethyl)-2-azaspiro[3.3]heptan-3-yl] 2-methylheptanoate (PubChem CID 175070506) has the molecular formula C15H27NO3
and a molecular weight of 269.38 g/mol. Its IUPAC name is [6-(hydroxymethyl)-2-azaspiro[3.3]heptan-3-yl] 2-methylheptanoate.
Molecular Properties
| Compound Name | [6-(hydroxymethyl)-2-azaspiro[3.3]heptan-3-yl] 2-methylheptanoate |
| PubChem CID | 175070506 |
| Molecular Formula | C15H27NO3 |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | [6-(hydroxymethyl)-2-azaspiro[3.3]heptan-3-yl] 2-methylheptanoate |
| SMILES | CCCCCC(C)C(=O)OC1NCC12CC(CO)C2 |
| InChI | InChI=1S/C15H27NO3/c1-3-4-5-6-11(2)13(18)19-14-15(10-16-14)7-12(8-15)9-17/h11-12,14,16-17H,3-10H2,1-2H3 |
| InChIKey | GVILYELMYPETSM-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [6-(hydroxymethyl)-2-azaspiro[3.3]heptan-3-yl] 2-methylheptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(hydroxymethyl)-2-azaspiro[3.3]heptan-3-yl] 2-methylheptanoate?
The IUPAC name of [6-(hydroxymethyl)-2-azaspiro[3.3]heptan-3-yl] 2-methylheptanoate (CID 175070506) is [6-(hydroxymethyl)-2-azaspiro[3.3]heptan-3-yl] 2-methylheptanoate.
What is the SMILES notation for [6-(hydroxymethyl)-2-azaspiro[3.3]heptan-3-yl] 2-methylheptanoate?
The canonical SMILES for [6-(hydroxymethyl)-2-azaspiro[3.3]heptan-3-yl] 2-methylheptanoate is CCCCCC(C)C(=O)OC1NCC12CC(CO)C2.
What is the InChIKey of [6-(hydroxymethyl)-2-azaspiro[3.3]heptan-3-yl] 2-methylheptanoate?
The InChIKey is GVILYELMYPETSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27NO3/c1-3-4-5-6-11(2)13(18)19-14-15(10-16-14)7-12(8-15)9-17/h11-12,14,16-17H,3-10H2,1-2H3.
What are the key properties of [6-(hydroxymethyl)-2-azaspiro[3.3]heptan-3-yl] 2-methylheptanoate?
[6-(hydroxymethyl)-2-azaspiro[3.3]heptan-3-yl] 2-methylheptanoate has a molecular weight of 269.38 g/mol, XLogP of 2.06, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(hydroxymethyl)-2-azaspiro[3.3]heptan-3-yl] 2-methylheptanoate is sourced from PubChem (CID 175070506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).