C22H32N2O3 — CID 175112914
[2-(2,3-dimethylbenzoyl)-2,6-diazaspiro[3.3]heptan-7-yl] 2-methylheptanoate (PubChem CID 175112914) has the molecular formula C22H32N2O3 and a molecular weight of 372.51 g/mol. Its IUPAC name is [2-(2,3-dimethylbenzoyl)-2,6-diazaspiro[3.3]heptan-7-yl] 2-methylheptanoate.
| Compound Name | [2-(2,3-dimethylbenzoyl)-2,6-diazaspiro[3.3]heptan-7-yl] 2-methylheptanoate |
|---|---|
| PubChem CID | 175112914 |
| Molecular Formula | C22H32N2O3 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.24 |
| IUPAC Name | [2-(2,3-dimethylbenzoyl)-2,6-diazaspiro[3.3]heptan-7-yl] 2-methylheptanoate |
| SMILES | CCCCCC(C)C(=O)OC1NCC12CN(C(=O)c1cccc(C)c1C)C2 |
| InChI | InChI=1S/C22H32N2O3/c1-5-6-7-9-16(3)20(26)27-21-22(12-23-21)13-24(14-22)19(25)18-11-8-10-15(2)17(18)4/h8,10-11,16,21,23H,5-7,9,12-14H2,1-4H3 |
| InChIKey | YDRCMZCTOYYTQL-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|