C21H29FN2O3 — CID 175105214
[2-(3-fluoro-2-methylbenzoyl)-2,6-diazaspiro[3.3]heptan-7-yl] 2-methylheptanoate (PubChem CID 175105214) has the molecular formula C21H29FN2O3 and a molecular weight of 376.47 g/mol. Its IUPAC name is [2-(3-fluoro-2-methylbenzoyl)-2,6-diazaspiro[3.3]heptan-7-yl] 2-methylheptanoate.
| Compound Name | [2-(3-fluoro-2-methylbenzoyl)-2,6-diazaspiro[3.3]heptan-7-yl] 2-methylheptanoate |
|---|---|
| PubChem CID | 175105214 |
| Molecular Formula | C21H29FN2O3 |
| Molecular Weight | 376.47 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | [2-(3-fluoro-2-methylbenzoyl)-2,6-diazaspiro[3.3]heptan-7-yl] 2-methylheptanoate |
| SMILES | CCCCCC(C)C(=O)OC1NCC12CN(C(=O)c1cccc(F)c1C)C2 |
| InChI | InChI=1S/C21H29FN2O3/c1-4-5-6-8-14(2)19(26)27-20-21(11-23-20)12-24(13-21)18(25)16-9-7-10-17(22)15(16)3/h7,9-10,14,20,23H,4-6,8,11-13H2,1-3H3 |
| InChIKey | NBWCIWUGXLJUNV-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.47 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|