C27H45N3O2 — CID 175175099
[9-(4-aminophenyl)-2,9-diazaspiro[5.5]undecan-1-yl] 2-methylundecanoate (PubChem CID 175175099) has the molecular formula C27H45N3O2 and a molecular weight of 443.68 g/mol. Its IUPAC name is [9-(4-aminophenyl)-2,9-diazaspiro[5.5]undecan-1-yl] 2-methylundecanoate.
| Compound Name | [9-(4-aminophenyl)-2,9-diazaspiro[5.5]undecan-1-yl] 2-methylundecanoate |
|---|---|
| PubChem CID | 175175099 |
| Molecular Formula | C27H45N3O2 |
| Molecular Weight | 443.68 g/mol |
| Exact Mass | 443.35 |
| IUPAC Name | [9-(4-aminophenyl)-2,9-diazaspiro[5.5]undecan-1-yl] 2-methylundecanoate |
| SMILES | CCCCCCCCCC(C)C(=O)OC1NCCCC12CCN(c1ccc(N)cc1)CC2 |
| InChI | InChI=1S/C27H45N3O2/c1-3-4-5-6-7-8-9-11-22(2)25(31)32-26-27(16-10-19-29-26)17-20-30(21-18-27)24-14-12-23(28)13-15-24/h12-15,22,26,29H,3-11,16-21,28H2,1-2H3 |
| InChIKey | UCFOWILGXDFHQY-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.68 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|