C7H11ClO3 — CID 175073383
(4R,6S)-6-(chloromethyl)-4-hydroxyoxane-2-carbaldehyde (PubChem CID 175073383) has the molecular formula C7H11ClO3 and a molecular weight of 178.61 g/mol. Its IUPAC name is (4R,6S)-6-(chloromethyl)-4-hydroxyoxane-2-carbaldehyde.
| Compound Name | (4R,6S)-6-(chloromethyl)-4-hydroxyoxane-2-carbaldehyde |
|---|---|
| PubChem CID | 175073383 |
| Molecular Formula | C7H11ClO3 |
| Molecular Weight | 178.61 g/mol |
| Exact Mass | 178.04 |
| IUPAC Name | (4R,6S)-6-(chloromethyl)-4-hydroxyoxane-2-carbaldehyde |
| SMILES | O=CC1C[C@@H](O)C[C@@H](CCl)O1 |
| InChI | InChI=1S/C7H11ClO3/c8-3-6-1-5(10)2-7(4-9)11-6/h4-7,10H,1-3H2/t5-,6-,7?/m0/s1 |
| InChIKey | ZVGMFMRIBLHJTQ-WABBHOIFSA-N |
| XLogP | 0.33 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.61 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|