About triethoxysilylmethyl 2-methylpropane-2-sulfonate
triethoxysilylmethyl 2-methylpropane-2-sulfonate (PubChem CID 175076962) has the molecular formula C11H26O6SSi
and a molecular weight of 314.48 g/mol. Its IUPAC name is triethoxysilylmethyl 2-methylpropane-2-sulfonate.
Molecular Properties
| Compound Name | triethoxysilylmethyl 2-methylpropane-2-sulfonate |
| PubChem CID | 175076962 |
| Molecular Formula | C11H26O6SSi |
| Molecular Weight | 314.48 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | triethoxysilylmethyl 2-methylpropane-2-sulfonate |
| SMILES | CCO[Si](COS(=O)(=O)C(C)(C)C)(OCC)OCC |
| InChI | InChI=1S/C11H26O6SSi/c1-7-15-19(16-8-2,17-9-3)10-14-18(12,13)11(4,5)6/h7-10H2,1-6H3 |
| InChIKey | GBAWVKJRCLWNKI-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.48 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze triethoxysilylmethyl 2-methylpropane-2-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethoxysilylmethyl 2-methylpropane-2-sulfonate?
The IUPAC name of triethoxysilylmethyl 2-methylpropane-2-sulfonate (CID 175076962) is triethoxysilylmethyl 2-methylpropane-2-sulfonate.
What is the SMILES notation for triethoxysilylmethyl 2-methylpropane-2-sulfonate?
The canonical SMILES for triethoxysilylmethyl 2-methylpropane-2-sulfonate is CCO[Si](COS(=O)(=O)C(C)(C)C)(OCC)OCC.
What is the InChIKey of triethoxysilylmethyl 2-methylpropane-2-sulfonate?
The InChIKey is GBAWVKJRCLWNKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H26O6SSi/c1-7-15-19(16-8-2,17-9-3)10-14-18(12,13)11(4,5)6/h7-10H2,1-6H3.
What are the key properties of triethoxysilylmethyl 2-methylpropane-2-sulfonate?
triethoxysilylmethyl 2-methylpropane-2-sulfonate has a molecular weight of 314.48 g/mol, XLogP of 1.72, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for triethoxysilylmethyl 2-methylpropane-2-sulfonate is sourced from PubChem (CID 175076962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).