C7H18Cl2N2O4 — CID 175077648
azane;2,2-dichloroacetic acid;2-[2-hydroxyethyl(methyl)amino]ethanol (PubChem CID 175077648) has the molecular formula C7H18Cl2N2O4 and a molecular weight of 265.14 g/mol. Its IUPAC name is azane;2,2-dichloroacetic acid;2-[2-hydroxyethyl(methyl)amino]ethanol.
| Compound Name | azane;2,2-dichloroacetic acid;2-[2-hydroxyethyl(methyl)amino]ethanol |
|---|---|
| PubChem CID | 175077648 |
| Molecular Formula | C7H18Cl2N2O4 |
| Molecular Weight | 265.14 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | azane;2,2-dichloroacetic acid;2-[2-hydroxyethyl(methyl)amino]ethanol |
| SMILES | CN(CCO)CCO.N.O=C(O)C(Cl)Cl |
| InChI | InChI=1S/C5H13NO2.C2H2Cl2O2.H3N/c1-6(2-4-7)3-5-8;3-1(4)2(5)6;/h7-8H,2-5H2,1H3;1H,(H,5,6);1H3 |
| InChIKey | ALAJXJGVLWWGSZ-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 116.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.14 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|