About lithium;difluorophosphinimyl 3-fluoro-3-oxopropanoate;hydride
lithium;difluorophosphinimyl 3-fluoro-3-oxopropanoate;hydride (PubChem CID 175084012) has the molecular formula C3H4F3LiNO3P
and a molecular weight of 196.98 g/mol. Its IUPAC name is lithium;difluorophosphinimyl 3-fluoro-3-oxopropanoate;hydride.
Molecular Properties
| Compound Name | lithium;difluorophosphinimyl 3-fluoro-3-oxopropanoate;hydride |
| PubChem CID | 175084012 |
| Molecular Formula | C3H4F3LiNO3P |
| Molecular Weight | 196.98 g/mol |
| Exact Mass | 197.00 |
| IUPAC Name | lithium;difluorophosphinimyl 3-fluoro-3-oxopropanoate;hydride |
| SMILES | [H-].[H]N=P(F)(F)OC(=O)CC(=O)F.[Li+] |
| InChI | InChI=1S/C3H3F3NO3P.Li.H/c4-2(8)1-3(9)10-11(5,6)7;;/h7H,1H2;;/q;+1;-1 |
| InChIKey | WEPLSRXQQPKPHO-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 67.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.98 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze lithium;difluorophosphinimyl 3-fluoro-3-oxopropanoate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;difluorophosphinimyl 3-fluoro-3-oxopropanoate;hydride?
The IUPAC name of lithium;difluorophosphinimyl 3-fluoro-3-oxopropanoate;hydride (CID 175084012) is lithium;difluorophosphinimyl 3-fluoro-3-oxopropanoate;hydride.
What is the SMILES notation for lithium;difluorophosphinimyl 3-fluoro-3-oxopropanoate;hydride?
The canonical SMILES for lithium;difluorophosphinimyl 3-fluoro-3-oxopropanoate;hydride is [H-].[H]N=P(F)(F)OC(=O)CC(=O)F.[Li+].
What is the InChIKey of lithium;difluorophosphinimyl 3-fluoro-3-oxopropanoate;hydride?
The InChIKey is WEPLSRXQQPKPHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H3F3NO3P.Li.H/c4-2(8)1-3(9)10-11(5,6)7;;/h7H,1H2;;/q;+1;-1.
What are the key properties of lithium;difluorophosphinimyl 3-fluoro-3-oxopropanoate;hydride?
lithium;difluorophosphinimyl 3-fluoro-3-oxopropanoate;hydride has a molecular weight of 196.98 g/mol, XLogP of -1.00, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;difluorophosphinimyl 3-fluoro-3-oxopropanoate;hydride is sourced from PubChem (CID 175084012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).