C6H11BClN3O3 — CID 175086767
(2,3,4-triaminophenoxy)boronic acid;hydrochloride (PubChem CID 175086767) has the molecular formula C6H11BClN3O3 and a molecular weight of 219.44 g/mol. Its IUPAC name is (2,3,4-triaminophenoxy)boronic acid;hydrochloride.
| Compound Name | (2,3,4-triaminophenoxy)boronic acid;hydrochloride |
|---|---|
| PubChem CID | 175086767 |
| Molecular Formula | C6H11BClN3O3 |
| Molecular Weight | 219.44 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | (2,3,4-triaminophenoxy)boronic acid;hydrochloride |
| SMILES | Cl.Nc1ccc(OB(O)O)c(N)c1N |
| InChI | InChI=1S/C6H10BN3O3.ClH/c8-3-1-2-4(13-7(11)12)6(10)5(3)9;/h1-2,11-12H,8-10H2;1H |
| InChIKey | IZXAAVWVTZXCDP-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 127.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.44 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|