About 2-methylperoxyethyl(propyl)silane;octadecanamide
2-methylperoxyethyl(propyl)silane;octadecanamide (PubChem CID 175093448) has the molecular formula C24H53NO3Si
and a molecular weight of 431.78 g/mol. Its IUPAC name is 2-methylperoxyethyl(propyl)silane;octadecanamide.
Molecular Properties
| Compound Name | 2-methylperoxyethyl(propyl)silane;octadecanamide |
| PubChem CID | 175093448 |
| Molecular Formula | C24H53NO3Si |
| Molecular Weight | 431.78 g/mol |
| Exact Mass | 431.38 |
| IUPAC Name | 2-methylperoxyethyl(propyl)silane;octadecanamide |
| SMILES | CCCCCCCCCCCCCCCCCC(N)=O.CCC[SiH2]CCOOC |
| InChI | InChI=1S/C18H37NO.C6H16O2Si/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-3-5-9-6-4-8-7-2/h2-17H2,1H3,(H2,19,20);3-6,9H2,1-2H3 |
| InChIKey | AZJPDWRLDFFKAE-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 431.78 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-methylperoxyethyl(propyl)silane;octadecanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylperoxyethyl(propyl)silane;octadecanamide?
The IUPAC name of 2-methylperoxyethyl(propyl)silane;octadecanamide (CID 175093448) is 2-methylperoxyethyl(propyl)silane;octadecanamide.
What is the SMILES notation for 2-methylperoxyethyl(propyl)silane;octadecanamide?
The canonical SMILES for 2-methylperoxyethyl(propyl)silane;octadecanamide is CCCCCCCCCCCCCCCCCC(N)=O.CCC[SiH2]CCOOC.
What is the InChIKey of 2-methylperoxyethyl(propyl)silane;octadecanamide?
The InChIKey is AZJPDWRLDFFKAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H37NO.C6H16O2Si/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-3-5-9-6-4-8-7-2/h2-17H2,1H3,(H2,19,20);3-6,9H2,1-2H3.
What are the key properties of 2-methylperoxyethyl(propyl)silane;octadecanamide?
2-methylperoxyethyl(propyl)silane;octadecanamide has a molecular weight of 431.78 g/mol, XLogP of 6.71, 22 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylperoxyethyl(propyl)silane;octadecanamide is sourced from PubChem (CID 175093448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).