C26H36BN3O2 — CID 175097329
1-[3-[2-(2-cyclopropylphenyl)pyrrolidin-1-yl]cyclobutyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (PubChem CID 175097329) has the molecular formula C26H36BN3O2 and a molecular weight of 433.41 g/mol. Its IUPAC name is 1-[3-[2-(2-cyclopropylphenyl)pyrrolidin-1-yl]cyclobutyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole.
| Compound Name | 1-[3-[2-(2-cyclopropylphenyl)pyrrolidin-1-yl]cyclobutyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
|---|---|
| PubChem CID | 175097329 |
| Molecular Formula | C26H36BN3O2 |
| Molecular Weight | 433.41 g/mol |
| Exact Mass | 433.29 |
| IUPAC Name | 1-[3-[2-(2-cyclopropylphenyl)pyrrolidin-1-yl]cyclobutyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| SMILES | CC1(C)OB(c2cnn(C3CC(N4CCCC4c4ccccc4C4CC4)C3)c2)OC1(C)C |
| InChI | InChI=1S/C26H36BN3O2/c1-25(2)26(3,4)32-27(31-25)19-16-28-30(17-19)21-14-20(15-21)29-13-7-10-24(29)23-9-6-5-8-22(23)18-11-12-18/h5-6,8-9,16-18,20-21,24H,7,10-15H2,1-4H3 |
| InChIKey | HLBAVHLTDBWVLM-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.41 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|