C23H19ClF3NO6S — CID 175098660
2,2-dimethylpropanoyl 3-[(4-carbamoyl-2,6-difluorophenoxy)methyl]-4-chloro-7-fluoro-5-methyl-1-benzothiophene-2-carboperoxoate (PubChem CID 175098660) has the molecular formula C23H19ClF3NO6S and a molecular weight of 529.92 g/mol. Its IUPAC name is 2,2-dimethylpropanoyl 3-[(4-carbamoyl-2,6-difluorophenoxy)methyl]-4-chloro-7-fluoro-5-methyl-1-benzothiophene-2-carboperoxoate.
| Compound Name | 2,2-dimethylpropanoyl 3-[(4-carbamoyl-2,6-difluorophenoxy)methyl]-4-chloro-7-fluoro-5-methyl-1-benzothiophene-2-carboperoxoate |
|---|---|
| PubChem CID | 175098660 |
| Molecular Formula | C23H19ClF3NO6S |
| Molecular Weight | 529.92 g/mol |
| Exact Mass | 529.06 |
| IUPAC Name | 2,2-dimethylpropanoyl 3-[(4-carbamoyl-2,6-difluorophenoxy)methyl]-4-chloro-7-fluoro-5-methyl-1-benzothiophene-2-carboperoxoate |
| SMILES | Cc1cc(F)c2sc(C(=O)OOC(=O)C(C)(C)C)c(COc3c(F)cc(C(N)=O)cc3F)c2c1Cl |
| InChI | InChI=1S/C23H19ClF3NO6S/c1-9-5-14(27)19-15(16(9)24)11(18(35-19)21(30)33-34-22(31)23(2,3)4)8-32-17-12(25)6-10(20(28)29)7-13(17)26/h5-7H,8H2,1-4H3,(H2,28,29) |
| InChIKey | MEMWDHDGUWYORV-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 104.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.92 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|