C15H13NO3S — CID 175099153
1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,5-benzothiazepin-2-one (PubChem CID 175099153) has the molecular formula C15H13NO3S and a molecular weight of 287.34 g/mol. Its IUPAC name is 1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,5-benzothiazepin-2-one.
| Compound Name | 1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,5-benzothiazepin-2-one |
|---|---|
| PubChem CID | 175099153 |
| Molecular Formula | C15H13NO3S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 1,1-dioxo-5-phenyl-3,4-dihydro-1λ6,5-benzothiazepin-2-one |
| SMILES | O=C1CCN(c2ccccc2)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C15H13NO3S/c17-15-10-11-16(12-6-2-1-3-7-12)13-8-4-5-9-14(13)20(15,18)19/h1-9H,10-11H2 |
| InChIKey | SZUXKJXKSRZYKW-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|